Products 7568-58-3
CAS 7568-58-3 appears in our catalog under these names: Tributyl–1–propene–1，2，3–tricarboxylate, Tributyl prop-1-ene-1,2,3-tricarboxylate 97% mix TBC as stabilizer, Tributyl prop-1-ene-1,2,3-tricarboxylate, 97% mix TBC as stabilizer, 97% mix TBC as stabilizer. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 500mg, 5g, 100mg, 250mg.
Tributyl (Z)-prop-1-ene-1,2,3-tricarboxylate (CAS 7568-58-3) is a chemical compound with the molecular formula C18H30O6 and a molecular weight of 342.4 g/mol. IUPAC name: tributyl (Z)-prop-1-ene-1,2,3-tricarboxylate. InChIKey: BANLNYYTSYHBAP-SQFISAMPSA-N.
| Molecular formula | C18H30O6 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | tributyl (Z)-prop-1-ene-1,2,3-tricarboxylate |
| InChIKey | BANLNYYTSYHBAP-SQFISAMPSA-N |
| SMILES | CCCCOC(=O)C/C(=C/C(=O)OCCCC)/C(=O)OCCCC |
Computed by PubChem (NCBI)
Synonyms:
Tributyl aconitate, Aconitic acid, tributyl ester, 1-Propene-1,2,3-tricarboxylic acid, tributyl ester, Tri-n-butyl aconitate, Tributyl aconitate [EP], Tributyl acetylcitrate impurity B [EP], TRIBUTYL ACONITATE [EP IMPURITY], 1,2,3-Propenetricarboxylic acid, tributyl ester, TRIBUTYL ACETYLCITRATE IMPURITY B [EP IMPURITY], 1-Propene-1,2,3-tricarboxylic acid, tris(N.-butyl ester)