Products 756813-87-3

CAS 756813-87-3 is the registry number for BVT.13, 98.44%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 100 mg, 50 mg.

Structural formula: {0} (CAS {1})

2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid (CAS 756813-87-3) is a chemical compound with the molecular formula C18H11Cl2N3O4 and a molecular weight of 404.2 g/mol. IUPAC name: 2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid. InChIKey: VNDRRWBKNSHALL-UHFFFAOYSA-N.

Identity
Molecular formulaC18H11Cl2N3O4
Molecular weight404.2 g/mol
IUPAC name2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid
InChIKeyVNDRRWBKNSHALL-UHFFFAOYSA-N
SMILESC1=CN=C(N=C1)OC2=CC(=C(C=C2)NC(=O)C3=C(C=C(C=C3)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)