CAS 756813-87-3 is the registry number for BVT.13, 98.44%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 100 mg, 50 mg.
2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid (CAS 756813-87-3) is a chemical compound with the molecular formula C18H11Cl2N3O4 and a molecular weight of 404.2 g/mol. IUPAC name: 2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid. InChIKey: VNDRRWBKNSHALL-UHFFFAOYSA-N.
| Molecular formula | C18H11Cl2N3O4 |
|---|---|
| Molecular weight | 404.2 g/mol |
| IUPAC name | 2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid |
| InChIKey | VNDRRWBKNSHALL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)OC2=CC(=C(C=C2)NC(=O)C3=C(C=C(C=C3)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)