Products 75684-45-6
CAS 75684-45-6 is the registry number for 7(8)-Dehydroschisandrol A. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.
(8Z,10S)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaene (CAS 75684-45-6) is a chemical compound with the molecular formula C24H30O6 and a molecular weight of 414.5 g/mol. IUPAC name: (8Z,10S)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaene. InChIKey: ILANPHGJGMYQMP-XXYUJHKVSA-N.
| Molecular formula | C24H30O6 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | (8Z,10S)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaene |
| InChIKey | ILANPHGJGMYQMP-XXYUJHKVSA-N |
| SMILES | C[C@H]/1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3/C=C1/C)OC)OC)OC)OC)OC)OC |
Computed by PubChem (NCBI)