CAS 75696-17-2 is the registry number for Sch 24937. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(6-bromo-5-chloro-3-pyridin-2-yl-1H-indol-2-yl)-2-methylsulfinylethanone (CAS 75696-17-2) is a chemical compound with the molecular formula C16H12BrClN2O2S and a molecular weight of 411.7 g/mol. IUPAC name: 1-(6-bromo-5-chloro-3-pyridin-2-yl-1H-indol-2-yl)-2-methylsulfinylethanone. InChIKey: QPUSHOZBKOBMDR-UHFFFAOYSA-N.
| Molecular formula | C16H12BrClN2O2S |
|---|---|
| Molecular weight | 411.7 g/mol |
| IUPAC name | 1-(6-bromo-5-chloro-3-pyridin-2-yl-1H-indol-2-yl)-2-methylsulfinylethanone |
| InChIKey | QPUSHOZBKOBMDR-UHFFFAOYSA-N |
| SMILES | CS(=O)CC(=O)C1=C(C2=CC(=C(C=C2N1)Br)Cl)C3=CC=CC=N3 |
Computed by PubChem (NCBI)