CAS 75707-39-0 is the registry number for H-L-Glu(oNB)-OH*HCl. Offered by: Iris Biotech. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g.
1-O-methyl 5-O-[(2-nitrophenyl)methyl] (2S)-2-aminopentanedioate;hydrochloride (CAS 75707-39-0) is a chemical compound with the molecular formula C13H17ClN2O6 and a molecular weight of 332.73 g/mol. IUPAC name: 1-O-methyl 5-O-[(2-nitrophenyl)methyl] (2S)-2-aminopentanedioate;hydrochloride. InChIKey: YCDKJLVBRKNUQX-PPHPATTJSA-N.
| Molecular formula | C13H17ClN2O6 |
|---|---|
| Molecular weight | 332.73 g/mol |
| IUPAC name | 1-O-methyl 5-O-[(2-nitrophenyl)methyl] (2S)-2-aminopentanedioate;hydrochloride |
| InChIKey | YCDKJLVBRKNUQX-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](CCC(=O)OCC1=CC=CC=C1[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)