CAS 757221-66-2 is the registry number for 2-Chloro-N-(4-chloro-1,1-dioxidotetrahydrothiophen-3-yl)acetamide, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide (CAS 757221-66-2) is a chemical compound with the molecular formula C6H9Cl2NO3S and a molecular weight of 246.11 g/mol. IUPAC name: 2-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide. InChIKey: XPRVHYWQGSYRSB-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl2NO3S |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | 2-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide |
| InChIKey | XPRVHYWQGSYRSB-UHFFFAOYSA-N |
| SMILES | C1C(C(CS1(=O)=O)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)