CAS 75732-01-3 appears in our catalog under these names: Mesitylcopper, Mesitylcopper(I), 30.6 - 39.0 %Cu, (2,4,6-Trimethylphenyl)copper, MESITYLCOPPER(I), Copper,(2,4,6-trimethylphenyl)-, 95%ï1/4ˆ30.6 - 39.0 %Cuï1/4‰,RG. Offered by: TRC, AmBeed, Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 250mg, 5g.
Copper(1+);1,3,5-trimethylbenzene-6-ide (CAS 75732-01-3) is a chemical compound with the molecular formula C9H11Cu and a molecular weight of 182.73 g/mol. IUPAC name: copper(1+);1,3,5-trimethylbenzene-6-ide. InChIKey: TYIFJJCPKPPNPM-UHFFFAOYSA-N.
| Molecular formula | C9H11Cu |
|---|---|
| Molecular weight | 182.73 g/mol |
| IUPAC name | copper(1+);1,3,5-trimethylbenzene-6-ide |
| InChIKey | TYIFJJCPKPPNPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=[C-]C(=C1)C)C.[Cu+] |
Computed by PubChem (NCBI)