Products 7575-82-8
CAS 7575-82-8 appears in our catalog under these names: 1-Nitroadamantane, 95%, 1-Nitroadamantane, >95% (GC), 1-Nitroadamantane, 1-Nitroadamantane 95+%, 1-Nitroadamantane, 95+%, 95+%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 2g.
1-nitroadamantane (CAS 7575-82-8) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: 1-nitroadamantane. InChIKey: HONLSNLUVRQMEK-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 1-nitroadamantane |
| InChIKey | HONLSNLUVRQMEK-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1-Nitroadamantane, Adamantane, 1-nitro-, nitroadamantane, Tricyclo[3.3.1.1(3,7)]decane, 1-nitro-, Tricyclo[3.3.1.13,7]decane, 1-nitro-, tricyclo[3.3.1.1~3,7~]decane, 1-nitro-, Tricyclo[3.3.1.13, 1-nitro-, Tricyclo(3.3.1.13,7)decane, 1-nitro-, 1-Nitrotricyclo[3.3.1.13,7]decane; NSC130990; NSC235788, 1-NitroadamantaneQ: What is