Products 757903-81-4

CAS 757903-81-4 appears in our catalog under these names: 5,6–Dimethylnicotinic acid, 5,6-Dimethylnicotinic acid 97%, 5,6-Dimethylnicotinic acid, 96%, 96%, 5,6-Dimethylnicotinic acid, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

5,6-dimethylpyridine-3-carboxylic acid (CAS 757903-81-4) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 5,6-dimethylpyridine-3-carboxylic acid. InChIKey: OTLMJDZYTWGGGP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO2
Molecular weight151.16 g/mol
IUPAC name5,6-dimethylpyridine-3-carboxylic acid
InChIKeyOTLMJDZYTWGGGP-UHFFFAOYSA-N
SMILESCC1=CC(=CN=C1C)C(=O)O

Computed by PubChem (NCBI)