CAS 757961-08-3 is the registry number for 1,1'-(1,2,4,5-Tetrazine-3,6-diyl)diguanidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
2-[6-(diaminomethylideneamino)-1,2,4,5-tetrazin-3-yl]guanidine (CAS 757961-08-3) is a chemical compound with the molecular formula C4H8N10 and a molecular weight of 196.17 g/mol. IUPAC name: 2-[6-(diaminomethylideneamino)-1,2,4,5-tetrazin-3-yl]guanidine. InChIKey: BULFEDHZYUMZFW-UHFFFAOYSA-N.
| Molecular formula | C4H8N10 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 2-[6-(diaminomethylideneamino)-1,2,4,5-tetrazin-3-yl]guanidine |
| InChIKey | BULFEDHZYUMZFW-UHFFFAOYSA-N |
| SMILES | C1(=NN=C(N=N1)N=C(N)N)N=C(N)N |
Computed by PubChem (NCBI)