CAS 758-42-9 is the registry number for 1,1,1-Trichlorotrifluoroacetone, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1,1,1-trichloro-3,3,3-trifluoropropan-2-one (CAS 758-42-9) is a chemical compound with the molecular formula C3Cl3F3O and a molecular weight of 215.38 g/mol. IUPAC name: 1,1,1-trichloro-3,3,3-trifluoropropan-2-one. InChIKey: AVTAIKNWAIKGEV-UHFFFAOYSA-N.
| Molecular formula | C3Cl3F3O |
|---|---|
| Molecular weight | 215.38 g/mol |
| IUPAC name | 1,1,1-trichloro-3,3,3-trifluoropropan-2-one |
| InChIKey | AVTAIKNWAIKGEV-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(F)F)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)