CAS 758-48-5 is the registry number for Perfluoro-N-Methyl-N,N-Diethylamine. Offered by: Biosynth. Available pack sizes: 0,5kg.
1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)ethanamine (CAS 758-48-5) is a chemical compound with the molecular formula C5F13N and a molecular weight of 321.04 g/mol. IUPAC name: 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)ethanamine. InChIKey: KMPITNDOTGKQSE-UHFFFAOYSA-N.
| Molecular formula | C5F13N |
|---|---|
| Molecular weight | 321.04 g/mol |
| IUPAC name | 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)ethanamine |
| InChIKey | KMPITNDOTGKQSE-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(N(C(C(F)(F)F)(F)F)C(F)(F)F)(F)F |
Computed by PubChem (NCBI)