CAS 7580-89-4 is the registry number for 4,4’-Dithiobis(2-(1,1-dimethylethyl)-phenol. Offered by: TRC. Available pack sizes: 250mg.
2-tert-butyl-4-[(3-tert-butyl-4-hydroxyphenyl)disulfanyl]phenol (CAS 7580-89-4) is a chemical compound with the molecular formula C20H26O2S2 and a molecular weight of 362.6 g/mol. IUPAC name: 2-tert-butyl-4-[(3-tert-butyl-4-hydroxyphenyl)disulfanyl]phenol. InChIKey: BEIZJWUDCUUSEF-UHFFFAOYSA-N.
| Molecular formula | C20H26O2S2 |
|---|---|
| Molecular weight | 362.6 g/mol |
| IUPAC name | 2-tert-butyl-4-[(3-tert-butyl-4-hydroxyphenyl)disulfanyl]phenol |
| InChIKey | BEIZJWUDCUUSEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)SSC2=CC(=C(C=C2)O)C(C)(C)C)O |
Computed by PubChem (NCBI)