CAS 75824-03-2 appears in our catalog under these names: Ethyl 5-chloro-3-(methylthio)-1,2,4-triazine-6-carboxylate, 95%, Ethyl 5-chloro-3-(methylthio)-1,2,4-triazine-6-carboxylate 95%, ethyl 5-chloro-3-(methylsulfanyl)-1,2,4-triazine-6-carboxylate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 25g, 5g, 250mg, 10g, 50g, 100g.
Ethyl 5-chloro-3-methylsulfanyl-1,2,4-triazine-6-carboxylate (CAS 75824-03-2) is a chemical compound with the molecular formula C7H8ClN3O2S and a molecular weight of 233.68 g/mol. IUPAC name: ethyl 5-chloro-3-methylsulfanyl-1,2,4-triazine-6-carboxylate. InChIKey: WXJHHRMJGBPYEG-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2S |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | ethyl 5-chloro-3-methylsulfanyl-1,2,4-triazine-6-carboxylate |
| InChIKey | WXJHHRMJGBPYEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(N=N1)SC)Cl |
Computed by PubChem (NCBI)