CAS 75840-25-4 is the registry number for (Z)-3-Amino-4,4,4-trifluoro-1-phenyl-2-buten-1-one, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(Z)-3-amino-4,4,4-trifluoro-1-phenylbut-2-en-1-one (CAS 75840-25-4) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: (Z)-3-amino-4,4,4-trifluoro-1-phenylbut-2-en-1-one. InChIKey: TUUKLDIAZOOYSM-TWGQIWQCSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | (Z)-3-amino-4,4,4-trifluoro-1-phenylbut-2-en-1-one |
| InChIKey | TUUKLDIAZOOYSM-TWGQIWQCSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C(/C(F)(F)F)\N |
Computed by PubChem (NCBI)