CAS 7585-41-3 appears in our catalog under these names: Pigment red 48:1, 95%, Pigment Red 48:1. Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 100g, 250g, 500g, 1000g, 2000g, 25g.
Barium(2+);2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate (CAS 7585-41-3) is a chemical compound with the molecular formula C18H11BaClN2O6S and a molecular weight of 556.1 g/mol. IUPAC name: barium(2+);2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate. InChIKey: BNZLJNRQXPJPJY-UHFFFAOYSA-L.
| Molecular formula | C18H11BaClN2O6S |
|---|---|
| Molecular weight | 556.1 g/mol |
| IUPAC name | barium(2+);2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate |
| InChIKey | BNZLJNRQXPJPJY-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C=C1Cl)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)O)[O-])S(=O)(=O)[O-].[Ba+2] |
Computed by PubChem (NCBI)