CAS 75859-03-9 appears in our catalog under these names: Rimcazole Dihydrochloride, Rimcazole dihydrochloride/ 99.88% (existing batch purity), Rimcazole dihydrochloride, 9-(3-(cis-3,5-Dimethylpiperazin-1-yl)propyl)-9H-carbazole dihydrochloride, 95%, 95%, Rimcazole (dihydrochloride), 99.96%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole;dihydrochloride (CAS 75859-03-9) is a chemical compound with the molecular formula C21H29Cl2N3 and a molecular weight of 394.4 g/mol. IUPAC name: 9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole;dihydrochloride. InChIKey: ZWHRZGHGYMUSRM-VWDRLOGHSA-N.
| Molecular formula | C21H29Cl2N3 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 9-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]propyl]carbazole;dihydrochloride |
| InChIKey | ZWHRZGHGYMUSRM-VWDRLOGHSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)CCCN2C3=CC=CC=C3C4=CC=CC=C42.Cl.Cl |
Computed by PubChem (NCBI)