CAS 758637-88-6 appears in our catalog under these names: Azelastine-d3, Azelastine–d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 50mg, 25 mg, 2.5 mg.
4-[(4-chlorophenyl)methyl]-2-[1-(trideuteriomethyl)azepan-4-yl]phthalazin-1-one (CAS 758637-88-6) is a chemical compound with the molecular formula C22H24ClN3O and a molecular weight of 384.9 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl]-2-[1-(trideuteriomethyl)azepan-4-yl]phthalazin-1-one. InChIKey: MBUVEWMHONZEQD-FIBGUPNXSA-N.
| Molecular formula | C22H24ClN3O |
|---|---|
| Molecular weight | 384.9 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methyl]-2-[1-(trideuteriomethyl)azepan-4-yl]phthalazin-1-one |
| InChIKey | MBUVEWMHONZEQD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCCC(CC1)N2C(=O)C3=CC=CC=C3C(=N2)CC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)