Products 758689-17-7
CAS 758689-17-7 is the registry number for Anti-infective agent 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-5-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-1,3-thiazol-2-amine (CAS 758689-17-7) is a chemical compound with the molecular formula C14H11F3N4S2 and a molecular weight of 356.4 g/mol. IUPAC name: 4-methyl-5-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-1,3-thiazol-2-amine. InChIKey: ZBWCLPCSGPKWDG-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N4S2 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 4-methyl-5-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-1,3-thiazol-2-amine |
| InChIKey | ZBWCLPCSGPKWDG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C2=CSC(=N2)NC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)