Products 75870-97-2

CAS 75870-97-2 is the registry number for 4-Chloro-2-methylbenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-chloro-2-methylbenzoyl fluoride (CAS 75870-97-2) is a chemical compound with the molecular formula C8H6ClFO and a molecular weight of 172.58 g/mol. IUPAC name: 4-chloro-2-methylbenzoyl fluoride. InChIKey: DMXBEFDSKNZEFB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClFO
Molecular weight172.58 g/mol
IUPAC name4-chloro-2-methylbenzoyl fluoride
InChIKeyDMXBEFDSKNZEFB-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)Cl)C(=O)F

Computed by PubChem (NCBI)