CAS 75966-16-4 is the registry number for p-Aminophenol Phosphate Disodium Salt . Offered by: TRC. Available pack sizes: 1g.
Disodium;(4-aminophenyl) phosphate (CAS 75966-16-4) is a chemical compound with the molecular formula C6H6NNa2O4P and a molecular weight of 233.07 g/mol. IUPAC name: disodium;(4-aminophenyl) phosphate. InChIKey: LQHGVLDZRKLMCR-UHFFFAOYSA-L.
| Molecular formula | C6H6NNa2O4P |
|---|---|
| Molecular weight | 233.07 g/mol |
| IUPAC name | disodium;(4-aminophenyl) phosphate |
| InChIKey | LQHGVLDZRKLMCR-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1N)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)