CAS 75980-60-8 appears in our catalog under these names: (Diphenylphosphoryl)(mesityl)methanone, 97%, Diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide, Diphenyl(2,4,6-trimethylbenzoyl)phosphine Oxide, >95% (HPLC), Diphenyl(2,4,6–trimethylbenzoyl)phosphine oxide, Diphenyl(2,4,6-trimethylbenzoyl)phosphine Oxide, >98.0%(HPLC). Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, GLPBio, Biosynth. Available pack sizes: 25g, 10g, 100mg, 1g, 500mg, 5g, 250g, 50g.
Diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone (CAS 75980-60-8) is a chemical compound with the molecular formula C22H21O2P and a molecular weight of 348.4 g/mol. IUPAC name: diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone. InChIKey: VFHVQBAGLAREND-UHFFFAOYSA-N.
| Molecular formula | C22H21O2P |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone |
| InChIKey | VFHVQBAGLAREND-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)