CAS 76-30-2 is the registry number for Tartrazine Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,3,3-tetrahydroxybutanedioic acid (CAS 76-30-2) is a chemical compound with the molecular formula C4H6O8 and a molecular weight of 182.09 g/mol. IUPAC name: 2,2,3,3-tetrahydroxybutanedioic acid. InChIKey: XHWHHMNORMIBBB-UHFFFAOYSA-N.
| Molecular formula | C4H6O8 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 2,2,3,3-tetrahydroxybutanedioic acid |
| InChIKey | XHWHHMNORMIBBB-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(=O)O)(O)O)(O)O)O |
Computed by PubChem (NCBI)