CAS 76-47-1 is the registry number for Hydrocortamate. Offered by: TRC, GLPBio. Available pack sizes: 2,5g, 250mg.
Hydrocortamate is a tertiary alpha-hydroxy ketone, a glucocorticoid, a 17alpha-hydroxy steroid, an 11beta-hydroxy steroid, a 3-oxo-Delta(4) steroid and a glycinyl ester. It has a role as an anti-inflammatory drug and an immunosuppressive agent. It is functionally related to a cortisone.
Source: ChEBI
| Molecular formula | C27H41NO6 |
|---|---|
| Molecular weight | 475.6 g/mol |
| IUPAC name | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-(diethylamino)acetate |
| InChIKey | FWFVLWGEFDIZMJ-FOMYWIRZSA-N |
| SMILES | CCN(CC)CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)O)C)O |
Computed by PubChem (NCBI)