Products 76-49-3
CAS 76-49-3 appears in our catalog under these names: Bornyl Acetate, Bornyl Acetate (Mixture of Diastereomers), >95% (GC), Bornyl Acetate, >95% (GC), Bornyl acetate, 90.00%, (+/-)-Bornyl acetate. Offered by: Chemat Brand, TRC, TargetMol, Chemat, Biosynth. Available pack sizes: on request, 10g, 2,5g, 25g, 100mg, 100g, 250g, 1g.
[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate (CAS 76-49-3) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. IUPAC name: [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate. InChIKey: KGEKLUUHTZCSIP-HOSYDEDBSA-N.
| Molecular formula | C12H20O2 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate |
| InChIKey | KGEKLUUHTZCSIP-HOSYDEDBSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2CC[C@]1(C2(C)C)C |
Computed by PubChem (NCBI)