CAS 76-52-8 is the registry number for Methadone Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
4-(dimethylamino)-3-methyl-2,2-diphenylbutanamide (CAS 76-52-8) is a chemical compound with the molecular formula C19H24N2O and a molecular weight of 296.4 g/mol. IUPAC name: 4-(dimethylamino)-3-methyl-2,2-diphenylbutanamide. InChIKey: QWCNOJBUASOCCZ-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 4-(dimethylamino)-3-methyl-2,2-diphenylbutanamide |
| InChIKey | QWCNOJBUASOCCZ-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)C(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)