Products 76-96-0

CAS 76-96-0 is the registry number for Methiotepa. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Tris(2-methylaziridin-1-yl)-sulfanylidene-lambda5-phosphane (CAS 76-96-0) is a chemical compound with the molecular formula C9H18N3PS and a molecular weight of 231.30 g/mol. IUPAC name: tris(2-methylaziridin-1-yl)-sulfanylidene-lambda5-phosphane. InChIKey: MLFGIRNMAOXTHS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18N3PS
Molecular weight231.30 g/mol
IUPAC nametris(2-methylaziridin-1-yl)-sulfanylidene-lambda5-phosphane
InChIKeyMLFGIRNMAOXTHS-UHFFFAOYSA-N
SMILESCC1CN1P(=S)(N2CC2C)N3CC3C

Computed by PubChem (NCBI)