CAS 76005-61-3 appears in our catalog under these names: Fluphenazine Decanoate Impurity 14, Fluphenazine N4-Oxide Sulphoxide, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-[1-oxido-4-[3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethanol (CAS 76005-61-3) is a chemical compound with the molecular formula C22H26F3N3O3S and a molecular weight of 469.5 g/mol. IUPAC name: 2-[1-oxido-4-[3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethanol. InChIKey: GOEZDFPKTBZVIW-UHFFFAOYSA-N.
| Molecular formula | C22H26F3N3O3S |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | 2-[1-oxido-4-[3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethanol |
| InChIKey | GOEZDFPKTBZVIW-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1CCCN2C3=CC=CC=C3S(=O)C4=C2C=C(C=C4)C(F)(F)F)(CCO)[O-] |
Computed by PubChem (NCBI)