CAS 76005-64-6 appears in our catalog under these names: Fluphenazine Decanoate N-Oxide, Fluphenazine Decanoate Impurity 12, Fluphenazine Decanoate N4-Oxide, >95% (HPLC), FLUPHENAZINE DECANOATE N4-OXIDE. Offered by: Chemat Brand, Hubei YoungXin, TRC, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 15MG.
2-[1-oxido-4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethyl decanoate (CAS 76005-64-6) is a chemical compound with the molecular formula C32H44F3N3O3S and a molecular weight of 607.8 g/mol. IUPAC name: 2-[1-oxido-4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethyl decanoate. InChIKey: JINJGQLVIHABHH-UHFFFAOYSA-N.
| Molecular formula | C32H44F3N3O3S |
|---|---|
| Molecular weight | 607.8 g/mol |
| IUPAC name | 2-[1-oxido-4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-ium-1-yl]ethyl decanoate |
| InChIKey | JINJGQLVIHABHH-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OCC[N+]1(CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F)[O-] |
Computed by PubChem (NCBI)