CAS 76023-99-9 is the registry number for (1R-cis)-Cyhalothric Acid, >95% (GC). Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Trans-(1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 76023-99-9) is a chemical compound with the molecular formula C9H10ClF3O2 and a molecular weight of 242.62 g/mol. IUPAC name: trans-(1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: SPVZAYWHHVLPBN-WREUKLMHSA-N.
| Molecular formula | C9H10ClF3O2 |
|---|---|
| Molecular weight | 242.62 g/mol |
| IUPAC name | trans-(1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | SPVZAYWHHVLPBN-WREUKLMHSA-N |
| SMILES | CC1([C@H]([C@H]1C(=O)O)/C=C(/C(F)(F)F)\Cl)C |
Computed by PubChem (NCBI)