CAS 76140-88-0 is the registry number for 2-[(2Z)-Azepan-2-ylidene]-2-cyanoacetamide, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2Z)-2-(azepan-2-ylidene)-2-cyanoacetamide (CAS 76140-88-0) is a chemical compound with the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. IUPAC name: (2Z)-2-(azepan-2-ylidene)-2-cyanoacetamide. InChIKey: XXBSPSWJXGJECJ-FPLPWBNLSA-N.
| Molecular formula | C9H13N3O |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2Z)-2-(azepan-2-ylidene)-2-cyanoacetamide |
| InChIKey | XXBSPSWJXGJECJ-FPLPWBNLSA-N |
| SMILES | C1CC/C(=C(\C#N)/C(=O)N)/NCC1 |
Computed by PubChem (NCBI)