CAS 761440-65-7 appears in our catalog under these names: 1-(1-(3-Methoxy-4-nitrophenyl)piperidin-4-yl)-4-methylpiperazine, 95%, 1–(1–(3–Methoxy–4–nitrophenyl)piperidin–4–yl)–4–methylpiperazine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g.
1-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-4-methylpiperazine (CAS 761440-65-7) is a chemical compound with the molecular formula C17H26N4O3 and a molecular weight of 334.4 g/mol. IUPAC name: 1-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-4-methylpiperazine. InChIKey: HNYSXOZEEKWPNM-UHFFFAOYSA-N.
| Molecular formula | C17H26N4O3 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 1-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-4-methylpiperazine |
| InChIKey | HNYSXOZEEKWPNM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2CCN(CC2)C3=CC(=C(C=C3)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)