Products 76145-88-5
CAS 76145-88-5 is the registry number for Ethyl 2-fluoro-2-[1,1,2-trifluoro-2-(perfluoropropoxy)propoxy]propionate, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
Ethyl 2-fluoro-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate (CAS 76145-88-5) is a chemical compound with the molecular formula C11H11F11O4 and a molecular weight of 416.18 g/mol. IUPAC name: ethyl 2-fluoro-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate. InChIKey: QCMMOZMMCFWTBJ-UHFFFAOYSA-N.
| Molecular formula | C11H11F11O4 |
|---|---|
| Molecular weight | 416.18 g/mol |
| IUPAC name | ethyl 2-fluoro-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
| InChIKey | QCMMOZMMCFWTBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(OC(C(C)(OC(C(C(F)(F)F)(F)F)(F)F)F)(F)F)F |
Computed by PubChem (NCBI)