CAS 76189-56-5 appears in our catalog under these names: (S)-BINAP, min. 98 %, 5 g, glass, (S)-BINAP, (S)-(-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl, 99+%, (S)-(-)-BINAP, (S)-(-)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'. Offered by: Roth, TRC, Thermo Scientific (Acros), TCI, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 500mg, 100g, 100mg, 10g, 25g.
[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane (CAS 76189-56-5) is a chemical compound with the molecular formula C44H32P2 and a molecular weight of 622.7 g/mol. IUPAC name: [1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane. InChIKey: MUALRAIOVNYAIW-UHFFFAOYSA-N.
| Molecular formula | C44H32P2 |
|---|---|
| Molecular weight | 622.7 g/mol |
| IUPAC name | [1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane |
| InChIKey | MUALRAIOVNYAIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)