CAS 76223-04-6 appears in our catalog under these names: 5'–O–TBDMS–dU, 5'-O-TBDMS-dU, 96%, 96%, 5'-O-TBDMS-dU, 96.51%, 5'-O-TBDMS-dU, 96%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10mM/1mL, 100 mg.
1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (CAS 76223-04-6) is a chemical compound with the molecular formula C15H26N2O5Si and a molecular weight of 342.46 g/mol. IUPAC name: 1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: HCSHWGNMXQKRCF-DMDPSCGWSA-N.
| Molecular formula | C15H26N2O5Si |
|---|---|
| Molecular weight | 342.46 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | HCSHWGNMXQKRCF-DMDPSCGWSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=CC(=O)NC2=O)O |
Computed by PubChem (NCBI)