CAS 762266-07-9 appears in our catalog under these names: Citalopram Impurity 19, Escitalopram Impurity N. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
4-[bis(4-fluorophenyl)-hydroxymethyl]-3-(hydroxymethyl)benzonitrile (CAS 762266-07-9) is a chemical compound with the molecular formula C21H15F2NO2 and a molecular weight of 351.3 g/mol. IUPAC name: 4-[bis(4-fluorophenyl)-hydroxymethyl]-3-(hydroxymethyl)benzonitrile. InChIKey: BNUIKEORRSAIAY-UHFFFAOYSA-N.
| Molecular formula | C21H15F2NO2 |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | 4-[bis(4-fluorophenyl)-hydroxymethyl]-3-(hydroxymethyl)benzonitrile |
| InChIKey | BNUIKEORRSAIAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)F)(C3=C(C=C(C=C3)C#N)CO)O)F |
Computed by PubChem (NCBI)