Products 762273-00-7
CAS 762273-00-7 is the registry number for tert-butyl N-[(3S)-3-hydroxy-3-phenylpropyl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[(3S)-3-hydroxy-3-phenylpropyl]carbamate (CAS 762273-00-7) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl N-[(3S)-3-hydroxy-3-phenylpropyl]carbamate. InChIKey: UHMCJSCAZCSSEM-LBPRGKRZSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl N-[(3S)-3-hydroxy-3-phenylpropyl]carbamate |
| InChIKey | UHMCJSCAZCSSEM-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](C1=CC=CC=C1)O |
Computed by PubChem (NCBI)