CAS 7623-01-0 is the registry number for 2,4,6,8-Tetraethyl-2,4,6,8-tetramethylcyclotetrasiloxane, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
2,4,6,8-tetraethyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 7623-01-0) is a chemical compound with the molecular formula C12H32O4Si4 and a molecular weight of 352.72 g/mol. IUPAC name: 2,4,6,8-tetraethyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: PPFOGBSWFQJMKW-UHFFFAOYSA-N.
| Molecular formula | C12H32O4Si4 |
|---|---|
| Molecular weight | 352.72 g/mol |
| IUPAC name | 2,4,6,8-tetraethyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | PPFOGBSWFQJMKW-UHFFFAOYSA-N |
| SMILES | CC[Si]1(O[Si](O[Si](O[Si](O1)(C)CC)(C)CC)(C)CC)C |
Computed by PubChem (NCBI)