Products 76231-76-0
CAS 76231-76-0 appears in our catalog under these names: Alpha,Beta-Thujone (>90%), a,b-Thujone (>90%), alpha,beta-Thujone, ALPHA+BETA-THUJONE, α,β-Thujone. Offered by: TRC, Biosynth, Sigma-Aldrich, MedChemExpress, Roth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 500mg, 1000mg, 10ML.
(1S,5R)-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one (CAS 76231-76-0) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1S,5R)-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one. InChIKey: USMNOWBWPHYOEA-VWHDNNRLSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1S,5R)-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one |
| InChIKey | USMNOWBWPHYOEA-VWHDNNRLSA-N |
| SMILES | CC1[C@H]2C[C@]2(CC1=O)C(C)C |
Computed by PubChem (NCBI)