CAS 76265-69-5 appears in our catalog under these names: Fmoc–Lys(Tfa)–OH, Fmoc-L-Lys(TFA)-OH, Fmoc-Lys(Tfa)-OH 98%, Fmoc-Lys(Tfa)-OH, 99.80%, Fmoc-Lys(Tfa)-OH, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 250mg, 1g, 500g, 10 g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 76265-69-5) is a chemical compound with the molecular formula C23H23F3N2O5 and a molecular weight of 464.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: ZVLMWTPNDXNXSZ-IBGZPJMESA-N.
| Molecular formula | C23H23F3N2O5 |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| InChIKey | ZVLMWTPNDXNXSZ-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)