CAS 76302-56-2 appears in our catalog under these names: 4-Amino-3-fluorobiphenyl, 95%, 3-Fluoro-(1,1'-biphenyl)-4-amine, 4-Amino-3-fluorobiphenyl, ≥95%, ≥95%, 4-Amino-3-fluorobiphenyl, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
2-fluoro-4-phenylaniline (CAS 76302-56-2) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 2-fluoro-4-phenylaniline. InChIKey: XZXOKGACURMTIN-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 2-fluoro-4-phenylaniline |
| InChIKey | XZXOKGACURMTIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)