CAS 763105-97-1 is the registry number for tert-butyl (2R,3S)-3-hydroxy-2-methyl-piperidine-1-carboxylate, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate (CAS 763105-97-1) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate. InChIKey: ADVNLLSPFSWKPK-BDAKNGLRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2R,3S)-3-hydroxy-2-methylpiperidine-1-carboxylate |
| InChIKey | ADVNLLSPFSWKPK-BDAKNGLRSA-N |
| SMILES | C[C@@H]1[C@H](CCCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)