CAS 763113-06-0 appears in our catalog under these names: Olaparib Impurity F, Olaparib Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[3-[4-(cyclopropanecarbonyl)piperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (CAS 763113-06-0) is a chemical compound with the molecular formula C24H24N4O3 and a molecular weight of 416.5 g/mol. IUPAC name: 4-[[3-[4-(cyclopropanecarbonyl)piperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one. InChIKey: UMOUCKQSZGWWOH-UHFFFAOYSA-N.
| Molecular formula | C24H24N4O3 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 4-[[3-[4-(cyclopropanecarbonyl)piperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| InChIKey | UMOUCKQSZGWWOH-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)N2CCN(CC2)C(=O)C3=CC=CC(=C3)CC4=NNC(=O)C5=CC=CC=C54 |
Computed by PubChem (NCBI)