CAS 763114-04-1 appears in our catalog under these names: Olaparib Impurity 11, Olaparib Impurity 12, tert-butyl 4-(2-fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoyl)piperazine-1-carboxylate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g.
Tert-butyl 4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazine-1-carboxylate (CAS 763114-04-1) is a chemical compound with the molecular formula C25H27FN4O4 and a molecular weight of 466.5 g/mol. IUPAC name: tert-butyl 4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazine-1-carboxylate. InChIKey: LDWYSPDHYSLKIG-UHFFFAOYSA-N.
| Molecular formula | C25H27FN4O4 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | tert-butyl 4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazine-1-carboxylate |
| InChIKey | LDWYSPDHYSLKIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)C2=C(C=CC(=C2)CC3=NNC(=O)C4=CC=CC=C43)F |
Computed by PubChem (NCBI)