CAS 763139-35-1 appears in our catalog under these names: Boc–δ–azido–Nva–OH · DCHA, Boc-L-Orn(N3)-OH*CHA. Offered by: GLPBio, Creative Peptides. Available pack sizes: 1g, 5g, 250mg.
(2S)-5-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 763139-35-1) is a chemical compound with the molecular formula C10H18N4O4 and a molecular weight of 258.27 g/mol. IUPAC name: (2S)-5-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: SZKWPJYNWXEPRJ-ZETCQYMHSA-N.
| Molecular formula | C10H18N4O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2S)-5-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | SZKWPJYNWXEPRJ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)