CAS 76319-57-8 appears in our catalog under these names: (S)-Flurbiprofen (S)-(-)-Alpha-Methylbenzylamine Salt, (S)-Flurbiprofen (S)-(-)-a-Methylbenzylamine Salt. Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
(2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(1S)-1-phenylethanamine (CAS 76319-57-8) is a chemical compound with the molecular formula C23H24FNO2 and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(1S)-1-phenylethanamine. InChIKey: SXXYXEUZKYVLQA-DIQYCMFJSA-N.
| Molecular formula | C23H24FNO2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(1S)-1-phenylethanamine |
| InChIKey | SXXYXEUZKYVLQA-DIQYCMFJSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N.C[C@@H](C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)