CAS 76326-99-3 appears in our catalog under these names: N,N-Dimethyl Glucamine, N,N-Dimethylglucamine. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol (CAS 76326-99-3) is a chemical compound with the molecular formula C8H19NO5 and a molecular weight of 209.24 g/mol. IUPAC name: (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol. InChIKey: CUGDYSSBTWBKII-LXGUWJNJSA-N.
| Molecular formula | C8H19NO5 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol |
| InChIKey | CUGDYSSBTWBKII-LXGUWJNJSA-N |
| SMILES | CN(C)C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)