CAS 76347-13-2 appears in our catalog under these names: 2-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2-Isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, Isopropylboronic acid pinacol ester, Isopropylboronic acid pinacol ester, 98% . Offered by: Ambeed, Fluorochem, Chemat, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane (CAS 76347-13-2) is a chemical compound with the molecular formula C9H19BO2 and a molecular weight of 170.06 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane. InChIKey: MECCSFDHAVAAAW-UHFFFAOYSA-N.
| Molecular formula | C9H19BO2 |
|---|---|
| Molecular weight | 170.06 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| InChIKey | MECCSFDHAVAAAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)C |
Computed by PubChem (NCBI)