CAS 7635-54-3 appears in our catalog under these names: (1S)–(+)–Menthyl chloroformate, (+)-Menthyl Chloroformate, >97.0%(T), (1S)-(+)-Menthyl chloroformate 97%, (+)-MENTHYL CHLOROFORMATE (97% EE/GLC), (1S)-(+)-Menthyl chloroformate. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1ml, 5ml, 25ml, 250mg, 1g, 5g, 25g, 5 g.
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate (CAS 7635-54-3) is a chemical compound with the molecular formula C11H19ClO2 and a molecular weight of 218.72 g/mol. IUPAC name: [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate. InChIKey: KIUPCUCGVCGPPA-AEJSXWLSSA-N.
| Molecular formula | C11H19ClO2 |
|---|---|
| Molecular weight | 218.72 g/mol |
| IUPAC name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate |
| InChIKey | KIUPCUCGVCGPPA-AEJSXWLSSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)OC(=O)Cl)C(C)C |
Computed by PubChem (NCBI)