CAS 76350-03-3 appears in our catalog under these names: Iopromide Impurity 18, Iopromide Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzene-1,3-dicarbonyl chloride (CAS 76350-03-3) is a chemical compound with the molecular formula C11H6Cl2I3NO4 and a molecular weight of 667.79 g/mol. IUPAC name: 2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzene-1,3-dicarbonyl chloride. InChIKey: ROJNTQLNMWYIQO-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2I3NO4 |
|---|---|
| Molecular weight | 667.79 g/mol |
| IUPAC name | 2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzene-1,3-dicarbonyl chloride |
| InChIKey | ROJNTQLNMWYIQO-UHFFFAOYSA-N |
| SMILES | COCC(=O)NC1=C(C(=C(C(=C1I)C(=O)Cl)I)C(=O)Cl)I |
Computed by PubChem (NCBI)